CAS 1263376-71-1 appears in our catalog under these names: Moxifloxacin Impurity 103, Moxifloxacin Impurity 67. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4-trifluoro-5-methoxybenzoyl chloride (CAS 1263376-71-1) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2,3,4-trifluoro-5-methoxybenzoyl chloride. InChIKey: IRRCNIFBIKZTNR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-methoxybenzoyl chloride |
| InChIKey | IRRCNIFBIKZTNR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)Cl)F)F)F |
Computed by PubChem (NCBI)