Products 1263377-60-1
CAS 1263377-60-1 appears in our catalog under these names: 5-(2-Cyanophenyl)nicotinic acid, 95+%, 95+%, 5-(2-Cyanophenyl)nicotinic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-(2-cyanophenyl)pyridine-3-carboxylic acid (CAS 1263377-60-1) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 5-(2-cyanophenyl)pyridine-3-carboxylic acid. InChIKey: ZDZSTNJZTGNOQM-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 5-(2-cyanophenyl)pyridine-3-carboxylic acid |
| InChIKey | ZDZSTNJZTGNOQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)