CAS 1265634-97-6 is the registry number for 5-Chloro-3-phenyl-3,4-dihydropyrido[2,3-d]pyrimidin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-phenyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (CAS 1265634-97-6) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 5-chloro-3-phenyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one. InChIKey: ZQIUKEJBRYECGU-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| InChIKey | ZQIUKEJBRYECGU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2NC(=O)N1C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)