CAS 1394791-54-8 appears in our catalog under these names: 5-(4-Chloro-3-ethylphenoxy)pyrazine-2-carbonitrile, 98%, 5-(4-Chloro-3-ethylphenoxy)pyrazine-2-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(4-chloro-3-ethylphenoxy)pyrazine-2-carbonitrile (CAS 1394791-54-8) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 5-(4-chloro-3-ethylphenoxy)pyrazine-2-carbonitrile. InChIKey: SZHAXDZXCAXPJB-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 5-(4-chloro-3-ethylphenoxy)pyrazine-2-carbonitrile |
| InChIKey | SZHAXDZXCAXPJB-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)OC2=NC=C(N=C2)C#N)Cl |
Computed by PubChem (NCBI)