CAS 952948-88-8 is the registry number for 2-(3-Amino-4-chlorophenyl)benzo[d]oxazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-amino-4-chlorophenyl)-1,3-benzoxazol-5-amine (CAS 952948-88-8) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 2-(3-amino-4-chlorophenyl)-1,3-benzoxazol-5-amine. InChIKey: AKCWBRLZNJXKGV-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-(3-amino-4-chlorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | AKCWBRLZNJXKGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC3=C(O2)C=CC(=C3)N)N)Cl |
Computed by PubChem (NCBI)