CAS 189018-17-5 is the registry number for 6-Chloro-5-methyl-2-phenylpyrazolo(1,5-a)pyrimidin-7-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-5-methyl-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 189018-17-5) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 6-chloro-5-methyl-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: SSAJCSRUENTPGH-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 6-chloro-5-methyl-2-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | SSAJCSRUENTPGH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)C=C(N2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)