CAS 338752-84-4 is the registry number for 2-(6-Chloropyridazin-3-yl)-2-(4-methoxyphenyl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-(6-chloropyridazin-3-yl)-2-(4-methoxyphenyl)acetonitrile (CAS 338752-84-4) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 2-(6-chloropyridazin-3-yl)-2-(4-methoxyphenyl)acetonitrile. InChIKey: BNXJYNKMIAFMGY-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-(6-chloropyridazin-3-yl)-2-(4-methoxyphenyl)acetonitrile |
| InChIKey | BNXJYNKMIAFMGY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C#N)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)