Products 1266379-28-5
CAS 1266379-28-5 appears in our catalog under these names: 2-(2-Isopropoxyphenyl)-4,4,5,5- tetramethyl-1,3,2-dioxaborolane, ≥95%, ≥95%, 2-(2-Isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
4,4,5,5-tetramethyl-2-(2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane (CAS 1266379-28-5) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane. InChIKey: AFVDJAPEQLXPME-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-propan-2-yloxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | AFVDJAPEQLXPME-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(C)C |
Computed by PubChem (NCBI)