Products 126689-82-5

CAS 126689-82-5 is the registry number for N-(4-Trifluoromethylphenyl)glycine methyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Methyl 2-[4-(trifluoromethyl)anilino]acetate (CAS 126689-82-5) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: methyl 2-[4-(trifluoromethyl)anilino]acetate. InChIKey: RCXFVOVWDMWLHH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F3NO2
Molecular weight233.19 g/mol
IUPAC namemethyl 2-[4-(trifluoromethyl)anilino]acetate
InChIKeyRCXFVOVWDMWLHH-UHFFFAOYSA-N
SMILESCOC(=O)CNC1=CC=C(C=C1)C(F)(F)F

Computed by PubChem (NCBI)