Products 1267009-28-8
CAS 1267009-28-8 is the registry number for 2-(3,4-Difluorophenyl)-2-methylcyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,4-difluorophenyl)-2-methylcyclopropane-1-carboxylic acid (CAS 1267009-28-8) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-2-methylcyclopropane-1-carboxylic acid. InChIKey: BZIXVZCPWVTUKP-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-2-methylcyclopropane-1-carboxylic acid |
| InChIKey | BZIXVZCPWVTUKP-UHFFFAOYSA-N |
| SMILES | CC1(CC1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)