CAS 1267318-33-1 is the registry number for 5-(5-Chlorothiophen-2-yl)-1,2-oxazol-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-amine (CAS 1267318-33-1) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-amine. InChIKey: AKHRFZWPCZSEBV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-amine |
| InChIKey | AKHRFZWPCZSEBV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=CC(=NO2)N |
Computed by PubChem (NCBI)