Products 1267440-90-3
CAS 1267440-90-3 is the registry number for 1-(4-Bromophenyl)-2-(1-piperidinyl)-1,2-ethanedione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-(4-bromophenyl)-2-piperidin-1-ylethane-1,2-dione (CAS 1267440-90-3) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: 1-(4-bromophenyl)-2-piperidin-1-ylethane-1,2-dione. InChIKey: MYXIBZMKUZVRNE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-piperidin-1-ylethane-1,2-dione |
| InChIKey | MYXIBZMKUZVRNE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)