Products 1267640-69-6
CAS 1267640-69-6 is the registry number for (4R)-1-Boc-4-(2-propyn-1-yloxy)-L-proline, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-ynoxypyrrolidine-2-carboxylic acid (CAS 1267640-69-6) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-ynoxypyrrolidine-2-carboxylic acid. InChIKey: VWQVJPIPDCZORR-ZJUUUORDSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-ynoxypyrrolidine-2-carboxylic acid |
| InChIKey | VWQVJPIPDCZORR-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)OCC#C |
Computed by PubChem (NCBI)