Products 1268045-87-9
CAS 1268045-87-9 is the registry number for 4-(4-Chlorophenyl)-4-methylpiperidine-2,6-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(4-chlorophenyl)-4-methylpiperidine-2,6-dione (CAS 1268045-87-9) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-methylpiperidine-2,6-dione. InChIKey: WKPKSOMBZAQNLC-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-methylpiperidine-2,6-dione |
| InChIKey | WKPKSOMBZAQNLC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC(=O)C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)