Products 1268520-00-8
CAS 1268520-00-8 appears in our catalog under these names: Benzyl 4-nitropiperidine-1-carboxylate, 95%, Benzyl 4–nitropiperidine–1–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Benzyl 4-nitropiperidine-1-carboxylate (CAS 1268520-00-8) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: benzyl 4-nitropiperidine-1-carboxylate. InChIKey: KGKFRBBNVOEUCI-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | benzyl 4-nitropiperidine-1-carboxylate |
| InChIKey | KGKFRBBNVOEUCI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1[N+](=O)[O-])C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)