Products 1268521-42-1
CAS 1268521-42-1 is the registry number for 6-chloro-1H-imidazo[4,5-c]pyridine-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-chloro-1H-imidazo[4,5-c]pyridine-4-carboxylic acid (CAS 1268521-42-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloro-1H-imidazo[4,5-c]pyridine-4-carboxylic acid. InChIKey: VHQUGPKTSYIPOR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 6-chloro-1H-imidazo[4,5-c]pyridine-4-carboxylic acid |
| InChIKey | VHQUGPKTSYIPOR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)C(=O)O)N=CN2 |
Computed by PubChem (NCBI)