CAS 1269226-67-6 is the registry number for [(4-Phenyl-1,3-thiazol-5-yl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride (CAS 1269226-67-6) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride. InChIKey: GFHXWVZFRGTBCT-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-5-yl)methanamine;dihydrochloride |
| InChIKey | GFHXWVZFRGTBCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)