CAS 89152-61-4 appears in our catalog under these names: (2-Phenyl-1,3-thiazol-4-yl)methanamine dihydrochloride, (2-Phenylthiazol-4-yl)methanamine dihydrochloride, 95%, 95%, (2-Phenyl-1,3-thiazol-4-yl)methylamine dihydrochloride, 95%. Offered by: Biosynth, Chemat, Combi-blocks. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g.
(2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride (CAS 89152-61-4) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: (2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride. InChIKey: IIJKGDUNHSXLGJ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | (2-phenyl-1,3-thiazol-4-yl)methanamine;dihydrochloride |
| InChIKey | IIJKGDUNHSXLGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CN.Cl.Cl |
Computed by PubChem (NCBI)