CAS 258347-64-7 is the registry number for 2-((3-Chlorobenzyl)thio)-4,5-dihydro-1H-imidazole Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 0,5g, 50mg.
2-[(3-chlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 258347-64-7) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: 2-[(3-chlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: IRJQVPJVGUVLRQ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | IRJQVPJVGUVLRQ-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)SCC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)