CAS 50310-70-8 appears in our catalog under these names: 2-((4-Methyl-1,3-thiazol-2-yl)methyl)pyridine dihydrochloride, 95%, 2-((4-Methyl-1,3-thiazol-2-yl)methyl)pyridine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazole;dihydrochloride (CAS 50310-70-8) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: 4-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazole;dihydrochloride. InChIKey: ORWQLEBPHSFBCU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | 4-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazole;dihydrochloride |
| InChIKey | ORWQLEBPHSFBCU-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CC2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)