CAS 1384429-73-5 appears in our catalog under these names: 2-(Azetidin-3-yl)-1,3-benzothiazole dihydrochloride, 98%, 2-(Azetidin-3-yl)-1,3-benzothiazole dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(azetidin-3-yl)-1,3-benzothiazole;dihydrochloride (CAS 1384429-73-5) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: 2-(azetidin-3-yl)-1,3-benzothiazole;dihydrochloride. InChIKey: XGLIPYJNKVTCGX-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-1,3-benzothiazole;dihydrochloride |
| InChIKey | XGLIPYJNKVTCGX-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=NC3=CC=CC=C3S2.Cl.Cl |
Computed by PubChem (NCBI)