CAS 913830-32-7 appears in our catalog under these names: (6-Thien-2-ylpyridin-3-yl)methylamine dihydrochloride, 90% , (6-(Thiophen-2-yl)pyridin-3-yl)methanamine dihydrochloride, 98%. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 250MG, 1g.
(6-thiophen-2-yl-3-pyridinyl)methanamine;dihydrochloride (CAS 913830-32-7) is a chemical compound with the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. IUPAC name: (6-thiophen-2-yl-3-pyridinyl)methanamine;dihydrochloride. InChIKey: FWNBHEVGWIALSL-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2S |
|---|---|
| Molecular weight | 263.19 g/mol |
| IUPAC name | (6-thiophen-2-yl-3-pyridinyl)methanamine;dihydrochloride |
| InChIKey | FWNBHEVGWIALSL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)