CAS 1269461-25-7 is the registry number for 2,4-Dichloro-6,8-dihydro-5H-pyrano(3,4-d)pyrimidine, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.
2,4-dichloro-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine (CAS 1269461-25-7) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,4-dichloro-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine. InChIKey: BDNFHGOSDKHGLO-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,4-dichloro-6,8-dihydro-5H-pyrano[3,4-d]pyrimidine |
| InChIKey | BDNFHGOSDKHGLO-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)