Products 1269529-72-7
CAS 1269529-72-7 appears in our catalog under these names: 2-{(4-(trifluoromethyl)phenyl)methyl}butanoic acid, 95%, 2-{(4-(Trifluoromethyl)phenyl)methyl}butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid (CAS 1269529-72-7) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid. InChIKey: PKVSFEKOLRXKJL-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid |
| InChIKey | PKVSFEKOLRXKJL-UHFFFAOYSA-N |
| SMILES | CCC(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)