CAS 1269773-23-0 appears in our catalog under these names: (S)–2–Amino–2–(2–chlorophenyl)ethanol hydrochloride, (S)-2-Amino-2-(2-chlorophenyl)ethanol hydrochloride, 95%, 95%, (S)-2-Amino-2-(2-chlorophenyl)ethanol hydrochloride, 98%, (S)-2-Amino-2-(2-chlorophenyl)ethanol hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2S)-2-amino-2-(2-chlorophenyl)ethanol;hydrochloride (CAS 1269773-23-0) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (2S)-2-amino-2-(2-chlorophenyl)ethanol;hydrochloride. InChIKey: FCJCVLVGGFRUIH-DDWIOCJRSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chlorophenyl)ethanol;hydrochloride |
| InChIKey | FCJCVLVGGFRUIH-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)