Products 1270301-86-4
CAS 1270301-86-4 appears in our catalog under these names: (4S)-6,8-Difluoro-3,4-dihydro-2H-1-benzopyran-4-ol, 95%, (4S)-6,8-Difluoro-3,4-dihydro-2H-1-benzopyran-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(4S)-6,8-difluoro-3,4-dihydro-2H-chromen-4-ol (CAS 1270301-86-4) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: (4S)-6,8-difluoro-3,4-dihydro-2H-chromen-4-ol. InChIKey: YIYJSJWWXNXVNN-QMMMGPOBSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | (4S)-6,8-difluoro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | YIYJSJWWXNXVNN-QMMMGPOBSA-N |
| SMILES | C1COC2=C([C@H]1O)C=C(C=C2F)F |
Computed by PubChem (NCBI)