Products 1270310-78-5
CAS 1270310-78-5 appears in our catalog under these names: 2-Amino-3-(2-Chloro-4-Methylphenyl)Propanoic Acid, 97%, 97%, 2-Amino-3-(2-chloro-4-methylphenyl)propanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
2-amino-3-(2-chloro-4-methylphenyl)propanoic acid (CAS 1270310-78-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-amino-3-(2-chloro-4-methylphenyl)propanoic acid. InChIKey: HYFOYEOZSRIHPU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-amino-3-(2-chloro-4-methylphenyl)propanoic acid |
| InChIKey | HYFOYEOZSRIHPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CC(C(=O)O)N)Cl |
Computed by PubChem (NCBI)