CAS 127221-02-7 appears in our catalog under these names: Diethyl 1H–indole–2,5–dicarboxylate, Diethyl 1H-indole-2,5-dicarboxylate 95%, Diethyl 1H-indole-2,5-dicarboxylate, 95%,RG, 95%,RG, Diethyl 1H-indole-2,5-dicarboxylate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Diethyl 1H-indole-2,5-dicarboxylate (CAS 127221-02-7) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: diethyl 1H-indole-2,5-dicarboxylate. InChIKey: IEFLIZMMNNHRSB-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | diethyl 1H-indole-2,5-dicarboxylate |
| InChIKey | IEFLIZMMNNHRSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C(=O)OCC |
Computed by PubChem (NCBI)