CAS 1272737-86-6 is the registry number for (S)-Methyl 3-amino-2,3-dihydrobenzofuran-6-carboxylate, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-6-carboxylate (CAS 1272737-86-6) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-6-carboxylate. InChIKey: AIFFLXZRXCBASW-MRVPVSSYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | methyl (3S)-3-amino-2,3-dihydro-1-benzofuran-6-carboxylate |
| InChIKey | AIFFLXZRXCBASW-MRVPVSSYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)[C@@H](CO2)N |
Computed by PubChem (NCBI)