Products 1273662-15-9
CAS 1273662-15-9 is the registry number for 7，8–Difluoro–3，4–dihydro–1(2H)–naphthalenone. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
7,8-difluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 1273662-15-9) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 7,8-difluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: QGAYQCGYIOGLKB-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 7,8-difluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | QGAYQCGYIOGLKB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)