CAS 1275177-44-0 is the registry number for Ethyl 2-(2-chloropropanamido)-5-methylthiophene-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 2-(2-chloropropanoylamino)-5-methylthiophene-3-carboxylate (CAS 1275177-44-0) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: ethyl 2-(2-chloropropanoylamino)-5-methylthiophene-3-carboxylate. InChIKey: VZZFKEVQOJQAPS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | ethyl 2-(2-chloropropanoylamino)-5-methylthiophene-3-carboxylate |
| InChIKey | VZZFKEVQOJQAPS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)