CAS 78234-18-1 appears in our catalog under these names: N-(4-(3-Chloropropanesulfonyl)phenyl)acetamide, 95%, N-(4-(3-Chloropropanesulfonyl)phenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
N-[4-(3-chloropropylsulfonyl)phenyl]acetamide (CAS 78234-18-1) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: N-[4-(3-chloropropylsulfonyl)phenyl]acetamide. InChIKey: VRKKNDAXAMMISK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | N-[4-(3-chloropropylsulfonyl)phenyl]acetamide |
| InChIKey | VRKKNDAXAMMISK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)CCCCl |
Computed by PubChem (NCBI)