CAS 1423623-33-9 is the registry number for 4-Chloro-N-((1-hydroxycyclobutyl)methyl)benzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-[(1-hydroxycyclobutyl)methyl]benzenesulfonamide (CAS 1423623-33-9) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: 4-chloro-N-[(1-hydroxycyclobutyl)methyl]benzenesulfonamide. InChIKey: ZWOGTHIDKNPMBM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | 4-chloro-N-[(1-hydroxycyclobutyl)methyl]benzenesulfonamide |
| InChIKey | ZWOGTHIDKNPMBM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CNS(=O)(=O)C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)