Products 169899-17-6
CAS 169899-17-6 appears in our catalog under these names: Lafutidine Impurity 9, Lafutidine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(Z)-4-chlorobut-2-enyl]-2-(furan-2-ylmethylsulfinyl)acetamide (CAS 169899-17-6) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: N-[(Z)-4-chlorobut-2-enyl]-2-(furan-2-ylmethylsulfinyl)acetamide. InChIKey: RPPUXVBPYZFIGO-UPHRSURJSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | N-[(Z)-4-chlorobut-2-enyl]-2-(furan-2-ylmethylsulfinyl)acetamide |
| InChIKey | RPPUXVBPYZFIGO-UPHRSURJSA-N |
| SMILES | C1=COC(=C1)CS(=O)CC(=O)NC/C=C\CCl |
Computed by PubChem (NCBI)