Products 1361572-46-4
CAS 1361572-46-4 appears in our catalog under these names: Lorcaserin Impurity 1, Lorcaserin Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(5R)-7-chloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-sulfonic acid (CAS 1361572-46-4) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: (5R)-7-chloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-sulfonic acid. InChIKey: YZUNJIOOIHWHGQ-QMMMGPOBSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | (5R)-7-chloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine-3-sulfonic acid |
| InChIKey | YZUNJIOOIHWHGQ-QMMMGPOBSA-N |
| SMILES | C[C@H]1CN(CCC2=C1C=C(C=C2)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)