CAS 477889-69-3 is the registry number for 4-[(4-Chlorophenyl)methoxy]-1lambda6-thiomorpholine-1,1-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(4-chlorophenyl)methoxy]-1,4-thiazinane 1,1-dioxide (CAS 477889-69-3) is a chemical compound with the molecular formula C11H14ClNO3S and a molecular weight of 275.75 g/mol. IUPAC name: 4-[(4-chlorophenyl)methoxy]-1,4-thiazinane 1,1-dioxide. InChIKey: JNLCMZJZSFTRMU-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3S |
|---|---|
| Molecular weight | 275.75 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methoxy]-1,4-thiazinane 1,1-dioxide |
| InChIKey | JNLCMZJZSFTRMU-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)