Products 1275552-69-6
CAS 1275552-69-6 appears in our catalog under these names: 2,2′-Diamino-4,4′-stilbenedicarboxylic acid, 2,2'-DIAMINO-4,4'-STILBENEDICARBOXYLIC &, 2,2′-Diamino-4,4′-stilbenedicarboxylic acid. Offered by: Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 500MG.
3-amino-4-[(E)-2-(2-amino-4-carboxyphenyl)ethenyl]benzoic acid (CAS 1275552-69-6) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 3-amino-4-[(E)-2-(2-amino-4-carboxyphenyl)ethenyl]benzoic acid. InChIKey: QEDSDXRFNGAJKN-OWOJBTEDSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 3-amino-4-[(E)-2-(2-amino-4-carboxyphenyl)ethenyl]benzoic acid |
| InChIKey | QEDSDXRFNGAJKN-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)/C=C/C2=C(C=C(C=C2)C(=O)O)N |
Computed by PubChem (NCBI)