CAS 1276295-04-5 is the registry number for L-threo-Droxidopa-13C2,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
(2S,3R)-2-(15N)azanyl-3-(3,4-dihydroxyphenyl)-3-hydroxy(1,2-13C2)propanoic acid (CAS 1276295-04-5) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 216.17 g/mol. IUPAC name: (2S,3R)-2-(15N)azanyl-3-(3,4-dihydroxyphenyl)-3-hydroxy(1,2-13C2)propanoic acid. InChIKey: QXWYKJLNLSIPIN-LJDYPDNASA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 216.17 g/mol |
| IUPAC name | (2S,3R)-2-(15N)azanyl-3-(3,4-dihydroxyphenyl)-3-hydroxy(1,2-13C2)propanoic acid |
| InChIKey | QXWYKJLNLSIPIN-LJDYPDNASA-N |
| SMILES | C1=CC(=C(C=C1[C@H]([13C@@H]([13C](=O)O)[15NH2])O)O)O |
Computed by PubChem (NCBI)