CAS 16322-99-9 appears in our catalog under these names: Droxidopa Impurity 5, Droxidopa Impurity 11 (DL-erythro-Droxidopa), Erythro-beta,3-dihydroxy-DL-tyrosine, DROXIDOPA ERYTHRO ISOMER. Offered by: Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 15MG.
(2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (CAS 16322-99-9) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: (2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid. InChIKey: QXWYKJLNLSIPIN-YUMQZZPRSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| InChIKey | QXWYKJLNLSIPIN-YUMQZZPRSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H]([C@@H](C(=O)O)N)O)O)O |
Computed by PubChem (NCBI)