Products 51829-99-3
CAS 51829-99-3 appears in our catalog under these names: Droxidopa Impurity 2, D-Threo-3,4-dihydroxyphenylserine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg, 100mg.
(2R,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (CAS 51829-99-3) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: (2R,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid. InChIKey: QXWYKJLNLSIPIN-SFYZADRCSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| InChIKey | QXWYKJLNLSIPIN-SFYZADRCSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H]([C@H](C(=O)O)N)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
D-Threo-dihydroxyphenylserine, Droxidopa enantiomer impurity, (+)-Threo-3,4-dihydroxyphenylserine, (2R,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid, Droxidopa Impurity 3, Droxydopa, L-threo-3,4-dihydroxyphenylserine, Droxidopa (L-DOPS,SM-5688), D-Threo-3,4-Dihydroxyphenylserine Hydrochloride, orb1225560