CAS 492-46-6 appears in our catalog under these names: H–DL–β–(3,4–Dihydroxyphenyl)–DL–Ser–OH, DL-3,4-DIHYDROXYPHENYLSERINE, >=98%&, β,3-Dihydroxytyrosine. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 250mg, 50mg, Get quote.
2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (CAS 492-46-6) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid. InChIKey: QXWYKJLNLSIPIN-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| InChIKey | QXWYKJLNLSIPIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(C(=O)O)N)O)O)O |
Computed by PubChem (NCBI)