Products 51829-98-2
CAS 51829-98-2 appears in our catalog under these names: Droxidopa Impurity 3, Droxidopa Impurity 1, erythro-beta,3-Dihydroxy-D-tyrosine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3R)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (CAS 51829-98-2) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: (2R,3R)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid. InChIKey: QXWYKJLNLSIPIN-HTQZYQBOSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2R,3R)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| InChIKey | QXWYKJLNLSIPIN-HTQZYQBOSA-N |
| SMILES | C1=CC(=C(C=C1[C@H]([C@H](C(=O)O)N)O)O)O |
Computed by PubChem (NCBI)