Products 1276355-35-1
CAS 1276355-35-1 is the registry number for Triflusal-13C6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 1 mg.
2-acetyloxy-4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1276355-35-1) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 254.11 g/mol. IUPAC name: 2-acetyloxy-4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: RMWVZGDJPAKBDE-BOCFXHSMSA-N.
| Molecular formula | C10H7F3O4 |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 2-acetyloxy-4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | RMWVZGDJPAKBDE-BOCFXHSMSA-N |
| SMILES | CC(=O)O[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)