CAS 2748541-63-9 is the registry number for Triflusal-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid (CAS 2748541-63-9) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 251.17 g/mol. IUPAC name: 2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid. InChIKey: RMWVZGDJPAKBDE-FIBGUPNXSA-N.
| Molecular formula | C10H7F3O4 |
|---|---|
| Molecular weight | 251.17 g/mol |
| IUPAC name | 2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | RMWVZGDJPAKBDE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC1=C(C=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)