Products 2748541-63-9

CAS 2748541-63-9 is the registry number for Triflusal-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.

Structural formula: {0} (CAS {1})

2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid (CAS 2748541-63-9) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 251.17 g/mol. IUPAC name: 2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid. InChIKey: RMWVZGDJPAKBDE-FIBGUPNXSA-N.

Identity
Molecular formulaC10H7F3O4
Molecular weight251.17 g/mol
IUPAC name2-(2,2,2-trideuterioacetyl)oxy-4-(trifluoromethyl)benzoic acid
InChIKeyRMWVZGDJPAKBDE-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(=O)OC1=C(C=CC(=C1)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)

Synonyms: Triflusal-d3