Products 2140326-72-1

CAS 2140326-72-1 is the registry number for Dimethyl 2,4,6-trifluorobenzene-1,3-dicarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 2,4,6-trifluorobenzene-1,3-dicarboxylate (CAS 2140326-72-1) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 248.15 g/mol. IUPAC name: dimethyl 2,4,6-trifluorobenzene-1,3-dicarboxylate. InChIKey: RMSVLEJJDALDNO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3O4
Molecular weight248.15 g/mol
IUPAC namedimethyl 2,4,6-trifluorobenzene-1,3-dicarboxylate
InChIKeyRMSVLEJJDALDNO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=C(C=C1F)F)C(=O)OC)F

Computed by PubChem (NCBI)