Products 954259-35-9

CAS 954259-35-9 is the registry number for 2-Oxo-3-(4-(trifluoromethoxy)phenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-oxo-3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 954259-35-9) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 248.15 g/mol. IUPAC name: 2-oxo-3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: SDCMENAXLZCVLB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3O4
Molecular weight248.15 g/mol
IUPAC name2-oxo-3-[4-(trifluoromethoxy)phenyl]propanoic acid
InChIKeySDCMENAXLZCVLB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)