Products 2171921-40-5
CAS 2171921-40-5 appears in our catalog under these names: 4-(Methoxycarbonyl)-3-(trifluoromethyl)benzoic acid, 4-(Methoxycarbonyl)-3-(trifluoromethyl)benzoic acid, 98%, 98%, 4-(Methoxycarbonyl)-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g, 10g.
4-methoxycarbonyl-3-(trifluoromethyl)benzoic acid (CAS 2171921-40-5) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 248.15 g/mol. IUPAC name: 4-methoxycarbonyl-3-(trifluoromethyl)benzoic acid. InChIKey: PRKSAANDQBPDTD-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O4 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 4-methoxycarbonyl-3-(trifluoromethyl)benzoic acid |
| InChIKey | PRKSAANDQBPDTD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)