Products 1928104-68-0

CAS 1928104-68-0 is the registry number for 2-Oxo-3-(3-(trifluoromethoxy)phenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxo-3-[3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1928104-68-0) is a chemical compound with the molecular formula C10H7F3O4 and a molecular weight of 248.15 g/mol. IUPAC name: 2-oxo-3-[3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: KBHPHNSKEICFOP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3O4
Molecular weight248.15 g/mol
IUPAC name2-oxo-3-[3-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyKBHPHNSKEICFOP-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC(F)(F)F)CC(=O)C(=O)O

Computed by PubChem (NCBI)