CAS 1280787-15-6 is the registry number for Fmoc-beta-Phe(4-Me)-OH (S). Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methylphenyl)propanoic acid (CAS 1280787-15-6) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methylphenyl)propanoic acid. InChIKey: CPAAZTTVXJKSDW-JOCHJYFZSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-methylphenyl)propanoic acid |
| InChIKey | CPAAZTTVXJKSDW-JOCHJYFZSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H](CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)