Products 1280963-78-1
CAS 1280963-78-1 is the registry number for N-(tert-Butyl)-4-chlorothiazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-4-chloro-1,3-thiazole-5-carboxamide (CAS 1280963-78-1) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: N-tert-butyl-4-chloro-1,3-thiazole-5-carboxamide. InChIKey: WZCJMLAHLWYGEB-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | N-tert-butyl-4-chloro-1,3-thiazole-5-carboxamide |
| InChIKey | WZCJMLAHLWYGEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(N=CS1)Cl |
Computed by PubChem (NCBI)